For research use only. Not for therapeutic Use.
Dimethylamino-p-tolyl-acetic acid(CAT: L042053) is a versatile organic compound featuring a dimethylamino group and a p-tolyl moiety linked to an acetic acid backbone. This high-purity molecule serves as a critical intermediate in pharmaceutical research, particularly in the synthesis of bioactive compounds and advanced materials. Its unique structure offers valuable reactivity for designing enzyme inhibitors, receptor modulators, and specialty chemicals. With excellent stability and solubility, Dimethylamino-p-tolyl-acetic acid supports innovative research in medicinal chemistry, fine chemical production, and the development of complex synthetic pathways.
CAS Number | 230646-18-1 |
Molecular Formula | C11H15NO2 |
Purity | ≥95% |
IUPAC Name | 2-(dimethylamino)-2-(4-methylphenyl)acetic acid |
InChI | InChI=1S/C11H15NO2/c1-8-4-6-9(7-5-8)10(11(13)14)12(2)3/h4-7,10H,1-3H3,(H,13,14) |
InChIKey | FPPJNXPDVUZZPS-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)C(C(=O)O)N(C)C |