For research use only. Not for therapeutic Use.
Dimethylanthranilate is an aromatic compound commonly used in the fragrance and flavor industry. With its fruity and floral scent reminiscent of grapes, it’s a popular ingredient in perfumes, cosmetics, and food flavorings. Additionally, it serves as a bird repellent in agricultural applications due to its aversive odor, helping to protect crops from bird damage. Its versatile applications and distinctive aroma make it a valuable component in various products.
| Catalog Number | R070477 |
| CAS Number | 85-91-6 |
| Synonyms | Methyl-N-methylanthranilate |
| Molecular Formula | C9H11NO2 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | RT |
| IUPAC Name | methyl 2-(methylamino)benzoate |
| InChI | InChI=1S/C9H11NO2/c1-10-8-6-4-3-5-7(8)9(11)12-2/h3-6,10H,1-2H3 |
| InChIKey | GVOWHGSUZUUUDR-UHFFFAOYSA-N |
| SMILES | CNC1=CC=CC=C1C(=O)OC |
