For research use only. Not for therapeutic Use.
Dimethyliodoarsine(CAT: R054940) is an organoarsenic compound. Its mode of action and pharmacological effects can involve its interactions with biological molecules and cellular processes due to its specific chemical structure. Dimethyliodoarsine is not widely studied or recognized for specific pharmacological actions or applications. However, organoarsenic compounds like dimethyliodoarsine have been investigated for their potential uses in fields such as organic synthesis, materials science, or coordination chemistry.
| Catalog Number | R054940 |
| CAS Number | 676-75-5 |
| Synonyms | Dimethylarsine iodide; Dimethylarsinous iodide; Dimethyliodoarsine; Iododimethylarsine; DMA-I |
| Molecular Formula | C2H6AsI |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | iodo(dimethyl)arsane |
| InChI | InChI=1S/C2H6AsI/c1-3(2)4/h1-2H3 |
| InChIKey | JHQSGZOIIRXESF-UHFFFAOYSA-N |
| SMILES | C[As](C)I |
