For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">Dimethylolurea (CAS 140-95-4) <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> are widely used as preservatives or additives.</span></span></span></span>
| Catalog Number | M070854 |
| CAS Number | 140-95-4 |
| Synonyms | 1,3-Bis(hydroxymethyl)urea; Oxymethurea; N,N’-Dimethylolurea |
| Molecular Formula | C3H8N2O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,3-bis(hydroxymethyl)urea |
| InChI | InChI=1S/C3H8N2O3/c6-1-4-3(8)5-2-7/h6-7H,1-2H2,(H2,4,5,8) |
| InChIKey | QUBQYFYWUJJAAK-UHFFFAOYSA-N |
| SMILES | C(NC(=O)NCO)O |
| Reference | 1.<span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Pfuhler, Stefan, and Hans Uwe Wolf. "Effects of the formaldehyde releasing preservatives dimethylol urea and diazolidinyl urea in several short-term genotoxicity tests." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Mutation Research/Genetic Toxicology and Environmental Mutagenesis</i><span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;"> 514.1-2 (2002): 133-146.<br /> |
