For research use only. Not for therapeutic Use.
Dimethylphosphine Oxide (Cat.No:M003122) is a chemical compound containing a phosphorus atom, two methyl groups, and an oxygen atom. It is a common phosphine oxide derivative used in organic synthesis and catalysis. Dimethylphosphine Oxide serves as a ligand in coordination chemistry and is also employed in various research and industrial applications.
CAS Number | 7211-39-4 |
Synonyms | Methylphosphinoylmethane;DIMETHYLPHOSPHINOUS ACID;DIMETHYLPHOSPHINE OXIDE;Einecs 230-591-2;Phosphine oxide, diMethyl-;Keto-Dimethyl-Phosphonium; |
Molecular Formula | C2H6OP+ |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | dimethyl(oxo)phosphanium |
InChI | InChI=1S/C2H6OP/c1-4(2)3/h1-2H3/q+1 |
InChIKey | WQAWEUZTDVWTDB-UHFFFAOYSA-N |
SMILES | C[P+](=O)C |
Reference | <p> |