For research use only. Not for therapeutic Use.
Dimetofrine (Cat No.:R057778) is a sympathomimetic drug that primarily acts as a vasoconstrictor, meaning it narrows blood vessels. It is used to treat low blood pressure (hypotension) and shock by increasing blood pressure and improving circulation. Dimetofrine works by stimulating alpha-adrenergic receptors in blood vessel walls, causing them to constrict and raise blood pressure. Due to its vasoconstrictive properties, it should be administered cautiously and under medical supervision.
| Catalog Number | R057778 |
| CAS Number | 22950-29-4 |
| Synonyms | 4-Hydroxy-3,5-dimethoxy-α-[(methylamino)methyl]benzenemethanol;?1-(3,5-Dimethoxy-4-hydroxyphenyl)-2-(methylamino)ethanol; 4-Hydroxy-3,5-dimethoxy-α-[(methylamino)methyl]benzyl Alcohol; Anassicol; Dimethophrine; Dimetrophine; |
| Molecular Formula | C11H17NO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-[1-hydroxy-2-(methylamino)ethyl]-2,6-dimethoxyphenol |
| InChI | InChI=1S/C11H17NO4/c1-12-6-8(13)7-4-9(15-2)11(14)10(5-7)16-3/h4-5,8,12-14H,6H2,1-3H3 |
| InChIKey | ZKGDBJAHIIXDDW-UHFFFAOYSA-N |
| SMILES | CNCC(C1=CC(=C(C(=C1)OC)O)OC)O |
| Reference | 1. <span style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Baldrighi, Vincenzo, et al. "Double-blind clinical evaluation of dimetophrine in chronically reduced arterial tension." </span><i style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Current medical research and opinion</i><span style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”> 9.2 (1984): 78-85.</span> |
