For research use only. Not for therapeutic Use.
Dimetridazole(Cat No.:)is an antiprotozoal and antibacterial agent commonly used in veterinary medicine to treat infections caused by anaerobic bacteria and protozoa, such as Trichomonas species in poultry and swine. It works by disrupting the DNA synthesis of these microorganisms, leading to their death and controlling the spread of infections. Dimetridazole is effective in preventing and treating diseases like swine dysentery and histomoniasis, promoting animal health and productivity. However, its use is restricted in some regions due to residue concerns in food products, emphasizing the need for cautious, regulated application.
CAS Number | 551-92-8 |
Molecular Formula | C5H7N3O2 |
Purity | ≥95% |
Target | Parasite |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | 1,2-dimethyl-5-nitroimidazole |
InChI | InChI=1S/C5H7N3O2/c1-4-6-3-5(7(4)2)8(9)10/h3H,1-2H3 |
InChIKey | IBXPYPUJPLLOIN-UHFFFAOYSA-N |
SMILES | CC1=NC=C(N1C)[N+](=O)[O-] |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |