For research use only. Not for therapeutic Use.
Dimiracetam(CAT: M109243) is a nootropic compound structurally related to piracetam, belonging to the racetam family of cognitive enhancers. It functions by modulating neurotransmission, particularly through interactions with glutamatergic and cholinergic systems, which play crucial roles in learning and memory processes. Dimiracetam has been investigated for its potential neuroprotective and cognition-enhancing properties, with studies suggesting its use in conditions involving neuropathic pain and neurodegenerative disorders such as Alzheimer’s disease. Given its mechanism of action, Dimiracetam is most relevant to Neurological Disease Research, particularly in studying therapeutic approaches for cognitive impairment, memory loss, and neuroprotection in degenerative brain diseases.
| Catalog Number | M109243 |
| CAS Number | 126100-97-8 |
| Synonyms | 3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-a]imidazole-2,5-dione |
| Molecular Formula | C6H8N2O2 |
| Purity | ≥95% |
| IUPAC Name | 3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-a]imidazole-2,5-dione |
| InChI | InChI=1S/C6H8N2O2/c9-5-3-8-4(7-5)1-2-6(8)10/h4H,1-3H2,(H,7,9) |
| InChIKey | XTXXOHPHLNROBN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N2C1NC(=O)C2 |
