For research use only. Not for therapeutic Use.
DiMNF (Cat No.:R059768) is a chemical compound used in research to study its potential biological effects, particularly in cancer research. It belongs to the class of nitroaromatic compounds, which are known for their ability to induce genetic mutations and affect cellular processes. DiMNF is often utilized to investigate its role in mutagenesis, genotoxicity, and its possible effects on DNA. It can also be used to explore mechanisms related to oxidative stress and carcinogenesis. Due to its chemical properties, DiMNF helps researchers better understand how certain compounds influence cellular function and gene expression.
| CAS Number | 14756-24-2 |
| Synonyms | 2-(3,4-dimethoxyphenyl)benzo[h]chromen-4-one |
| Molecular Formula | C21H16O4 |
| Purity | ≥95% |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)benzo[h]chromen-4-one |
| InChI | InChI=1S/C21H16O4/c1-23-18-10-8-14(11-20(18)24-2)19-12-17(22)16-9-7-13-5-3-4-6-15(13)21(16)25-19/h3-12H,1-2H3 |
| InChIKey | QDZQDIUUJDAORK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3)OC |
