For research use only. Not for therapeutic Use.
Tetrabutylammonium cyanide(Cat No.:M056276) is a quaternary ammonium salt where cyanide acts as the anion, making it a potent nucleophile and a useful reagent in organic synthesis. This colorless to pale yellow compound is soluble in polar solvents like water and alcohol and is typically used as a phase transfer catalyst in chemical reactions. It facilitates the transfer of cyanide ions across phases, enabling efficient cyanation processes. Applications include cyanide substitutions and the synthesis of nitriles from alkyl halides.
CAS Number | 14448-18-1 |
Molecular Formula | Ni2O7P2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | nickel(2+);phosphonato phosphate |
InChI | InChI=1S/2Ni.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+2;/p-4 |
InChIKey | OHPFZXJAABILIK-UHFFFAOYSA-J |
SMILES | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Ni+2].[Ni+2] |