For research use only. Not for therapeutic Use.
Dinobuton is a biochemcial.
| Catalog Number | I026219 |
| CAS Number | 973-21-7 |
| Synonyms | Kasebon; Sytasol; Talan |
| Molecular Formula | C14H18N2O7 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-sec-Butyl-4,6-dinitrophenyl isopropyl carbonate |
| InChI | InChI=1S/C14H18N2O7/c1-5-9(4)11-6-10(15(18)19)7-12(16(20)21)13(11)23-14(17)22-8(2)3/h6-9H,5H2,1-4H3 |
| InChIKey | HDWLUGYOLUHEMN-UHFFFAOYSA-N |
| SMILES | O=C(OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1C(C)CC)OC(C)C |
| Reference | 1: Trinus FP, Braver-Chernobul’skaia BS, Luĭk AI, Boldeskul AE, Velichko AN. [Changes in the secondary and tertiary structure of serum albumin in interactions with ligands of various structures]. Vopr Med Khim. 1984 Jul-Aug;30(4):48-50. Russian. PubMed PMID: 6239449. |
