For research use only. Not for therapeutic Use.
Dinonyl Phthalate is a high-performance plasticizer used in polymer and materials science. It imparts flexibility, durability, and improved processing characteristics to plastics and resins. This compound is essential for enhancing the physical properties of PVC and other polymeric materials, ensuring precise and reliable results in advanced industrial and manufacturing applications.
| Catalog Number | R016381 |
| CAS Number | 84-76-4 |
| Synonyms | Bisoflex 91; Bisoflex DNP; Di-n-nonyl Phthalate; Dinonyl 1,2-Benzenedicarboxylate; Dinonyl o-Phthalate; Unimoll DN; 1,2-Benzenedicarboxylic Acid Dinonyl Ester; Phthalic Acid Dinonyl Ester; 1,2-Benzenedicarboxylic Acid, 1,2-Dinonyl Ester |
| Molecular Formula | C26H42O4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | dinonyl benzene-1,2-dicarboxylate |
| InChI | InChI=1S/C26H42O4/c1-3-5-7-9-11-13-17-21-29-25(27)23-19-15-16-20-24(23)26(28)30-22-18-14-12-10-8-6-4-2/h15-16,19-20H,3-14,17-18,21-22H2,1-2H3 |
| InChIKey | DROMNWUQASBTFM-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC |
