For research use only. Not for therapeutic Use.
Dinotefuran-d3(Cat No.:R025319)is a deuterated form of dinotefuran, a broad-spectrum insecticide belonging to the neonicotinoid class. The deuterium substitution (d3) replaces three hydrogen atoms with the isotope deuterium, allowing for enhanced tracking and analysis in metabolic studies. Dinotefuran works by targeting the nicotinic acetylcholine receptors in insects, disrupting their nervous systems and leading to paralysis and death. The deuterated version is particularly useful in pharmacokinetic studies and environmental monitoring, providing more precise data on the compound’s absorption, distribution, metabolism, and excretion, helping to optimize its use and minimize environmental impact.
Synonyms | 1-nitro-3-(oxolan-3-ylmethyl)-2-(trideuteriomethyl)guanidine |
Molecular Formula | C7H11D3N4O3 |
Purity | ≥95% |
IUPAC Name | 1-nitro-3-(oxolan-3-ylmethyl)-2-(trideuteriomethyl)guanidine |
InChI | InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10)/i1D3 |
InChIKey | YKBZOVFACRVRJN-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])N=C(NCC1CCOC1)N[N+](=O)[O-] |