For research use only. Not for therapeutic Use.
Dinotefuran (Cat.No:I002161) is a neonicotinoid insecticide widely used in agriculture and pest control. It exhibits excellent systemic activity and broad-spectrum efficacy against various insect pests, including aphids, whiteflies, and leafhoppers. Dinotefuran disrupts the nervous system of insects, leading to paralysis and eventual death. Proper handling and application practices should be followed to ensure safety and environmental compliance.
| Catalog Number | I002161 |
| CAS Number | 165252-70-0 |
| Molecular Formula | C7H14N4O3 |
| Purity | ≥95% |
| Target | nAChR, Antiparasitic |
| Solubility | H2O: 39.83 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 1-methyl-2-nitro-3-(oxolan-3-ylmethyl)guanidine |
| InChI | InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10) |
| InChIKey | YKBZOVFACRVRJN-UHFFFAOYSA-N |
| SMILES | CNC(=N[N+](=O)[O-])NCC1CCOC1 |
| Reference | <p style=/line-height:25px/> |
