For research use only. Not for therapeutic Use.
Diosgenin glucoside(Cat No.:M063544), a saponin derived from Tritulus terrestris L., exhibits neuroprotective effects through various mechanisms. It influences microglial M1 polarization, promoting an anti-inflammatory response that helps protect neurons. Additionally, Diosgenin glucoside modulates autophagy, promoting cellular recycling and reducing apoptosis, which ultimately contributes to spinal cord injury protection. These multifaceted actions make it a potential therapeutic candidate for neurological disorders and spinal cord injuries, offering promise in the development of novel treatments to support and enhance neural health and function.
CAS Number | 14144-06-0 |
Molecular Formula | C33H52O8 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 2-8°C |
IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxyoxane-3,4,5-triol |
InChI | InChI=1S/C33H52O8/c1-17-7-12-33(38-16-17)18(2)26-24(41-33)14-23-21-6-5-19-13-20(8-10-31(19,3)22(21)9-11-32(23,26)4)39-30-29(37)28(36)27(35)25(15-34)40-30/h5,17-18,20-30,34-37H,6-16H2,1-4H3/t17-,18+,20+,21-,22+,23+,24+,25-,26+,27-,28+,29-,30-,31+,32+,33-/m1/s1 |
InChIKey | WXMARHKAXWRNDM-GAMIEDRGSA-N |
SMILES | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)O)C)C)C)OC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |