For research use only. Not for therapeutic Use.
Diosgenone(Cat No.:I026236)is a steroidal saponin compound derived from the plant Dioscorea species, particularly Dioscorea zingiberensis. It is known for its potential anti-inflammatory, antioxidant, and anticancer properties. Diosgenone exhibits activity by modulating various signaling pathways involved in cell proliferation, apoptosis, and inflammation. In cancer research, it has shown promise in inhibiting tumor growth and metastasis, possibly through the inhibition of NF-kB and other pro-inflammatory pathways. Its ability to target multiple molecular pathways makes diosgenone a candidate for therapeutic development in cancer and other inflammatory conditions.
CAS Number | 2137-22-6 |
Synonyms | Diosgenone |
Molecular Formula | C27H38O3 |
Purity | 98% |
Solubility | To be determined |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | (1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-6,2'-oxane]-16-one |
InChI | InChI=1S/C27H38O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h8,10,13,16-17,20-24H,5-7,9,11-12,14-15H2,1-4H3/t16-,17+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
InChIKey | QEGQIJLALWETNE-CLGLNXEMSA-N |
SMILES | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CCC6=CC(=O)C=C[C@]56C)C)C)OC1 |