For research use only. Not for therapeutic Use.
Dioxabenzofos (Cat.No:I026240) is an organophosphorus insecticide used to control various pests in agriculture. It exhibits broad-spectrum activity against insects and mites by inhibiting their nervous system. Due to its toxicity, strict handling and application guidelines should be followed to ensure safety and minimize environmental impact.
| Catalog Number | I026240 |
| CAS Number | 3811-49-2 |
| Synonyms | Dioxabenzofos; Salithion; |
| Molecular Formula | C8H9O3PS |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | 2-methoxy-4H-benzo[d][1,3,2]dioxaphosphinine 2-sulfide |
| InChI | InChI=1S/C8H9O3PS/c1-9-12(13)10-6-7-4-2-3-5-8(7)11-12/h2-5H,6H2,1H3 |
| InChIKey | OUNSASXJZHBGAI-UHFFFAOYSA-N |
| SMILES | COP1(OC2=CC=CC=C2CO1)=S |
