Dioxybenzone-d3（Cat No.:S001142） is a deuterated variant of Dioxybenzone, where three hydrogen atoms are replaced with deuterium. This modification enhances its stability, making it a valuable tool for studying the pharmacokinetics and metabolic stability of sunscreen agents. Dioxybenzone-d3 is utilized primarily in dermatological research to understand the absorption and long-term effects of UV filters on human skin. It provides critical insights into the safety and efficacy of sunscreen formulations, aiding in the development of more effective and longer-lasting sun protection products.
| Catalog Number | S001142 |
| Molecular Formula | C14H9D3O4 |
| Purity | ≥95% |
| IUPAC Name | (2-hydroxyphenyl)-[2-hydroxy-4-(trideuteriomethoxy)phenyl]methanone |
| InChI | InChI=1S/C14H12O4/c1-18-9-6-7-11(13(16)8-9)14(17)10-4-2-3-5-12(10)15/h2-8,15-16H,1H3/i1D3 |
| InChIKey | MEZZCSHVIGVWFI-FIBGUPNXSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2O)O |
