For research use only. Not for therapeutic Use.
Dioxybenzone（Cat No.:I001213） is an organic compound commonly utilized in sunscreens as a UV-filtering agent. It functions by absorbing and blocking UVB (ultraviolet B) and short-wave UVA (ultraviolet A) rays. By absorbing these harmful ultraviolet rays, dioxybenzone helps to protect the skin from potential damage caused by sun exposure, including sunburn and the risk of skin cancer. Its inclusion in sunscreen formulations enhances its efficacy in providing broad-spectrum sun protection. Dioxybenzone is considered a safe and effective ingredient in sunscreens and is widely used in various sun care products.
| Catalog Number | I001213 |
| CAS Number | 131-53-3 |
| Molecular Formula | C14H12O4 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | Room Temperature |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-(2-hydroxyphenyl)methanone |
| InChI | InChI=1S/C14H12O4/c1-18-9-6-7-11(13(16)8-9)14(17)10-4-2-3-5-12(10)15/h2-8,15-16H,1H3 |
| InChIKey | MEZZCSHVIGVWFI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2O)O |
| Reference | <p style=/line-height:25px/> |
