For research use only. Not for therapeutic Use.
Dipentylacetic acid(CAT: L015619) is a high-purity aliphatic carboxylic acid widely used in chemical and pharmaceutical research. Featuring a long-chain structure with two pentyl groups attached to an acetic acid backbone, this compound serves as a valuable intermediate in organic synthesis and the development of bioactive molecules. Its well-defined chemical properties make it suitable for studying structure-activity relationships and for use in designing specialized materials. Dipentylacetic acid ensures consistent performance in diverse experimental applications, supporting innovation in drug discovery, agrochemical development, and advanced material science.
CAS Number | 5422-52-6 |
Molecular Formula | C12H24O2 |
Purity | ≥95% |
IUPAC Name | 2-pentylheptanoic acid |
InChI | InChI=1S/C12H24O2/c1-3-5-7-9-11(12(13)14)10-8-6-4-2/h11H,3-10H2,1-2H3,(H,13,14) |
InChIKey | PLVOWOHSFJLXOR-UHFFFAOYSA-N |
SMILES | CCCCCC(CCCCC)C(=O)O |