For research use only. Not for therapeutic Use.
Diphenhydramine-d6 hydrochloride（Cat No.:S000338） is a deuterated form of diphenhydramine hydrochloride, where six hydrogen atoms are replaced with deuterium. Diphenhydramine is an antihistamine commonly used to treat allergy symptoms, motion sickness, and insomnia. The introduction of deuterium atoms increases the stability of the molecule, allowing for more precise and detailed pharmacokinetic and metabolic research.
| Catalog Number | S000338 |
| CAS Number | 1189986-72-8 |
| Molecular Formula | C17H16D6ClNO |
| Purity | ≥95% |
| IUPAC Name | 2-benzhydryloxy-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride |
| InChI | InChI=1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H/i1D3,2D3; |
| InChIKey | PCHPORCSPXIHLZ-TXHXQZCNSA-N |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
