For research use only. Not for therapeutic Use.
Diphenic acid (Cat. No: R070553) has the chemical reactivity of aromatic diacids, which can produce anhydrides, esters, imides, amides, and oxychlorides. Diphenic acid can be used as a pharmaceutical intermediate for the preparation of chemical materials.
CAS Number | 482-05-3 |
Synonyms | [1.1-Biphenyl]-2-2-dicarboxylic acid |
Molecular Formula | C14H10O4 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2-(2-carboxyphenyl)benzoic acid |
InChI | InChI=1S/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18) |
InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2C(=O)O)C(=O)O |