For research use only. Not for therapeutic Use.
Diphenyl diselenide is an organoselenium compound with two phenyl groups attached to a central selenium atom. It finds applications in organic synthesis, particularly as a reagent in the formation of carbon-selenium bonds. Additionally, diphenyl diselenide exhibits antioxidant and neuroprotective properties, making it a subject of interest in medicinal chemistry research for its potential therapeutic applications in conditions like neurodegenerative diseases.
| Catalog Number | R031054 |
| CAS Number | 1666-13-3 |
| Synonyms | Phenyl Diselenide; (Phenyldiselanyl)benzene; NSC 49763 |
| Molecular Formula | C12H10Se2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (phenyldiselanyl)benzene |
| InChI | InChI=1S/C12H10Se2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
| InChIKey | YWWZCHLUQSHMCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se][Se]C2=CC=CC=C2 |
