For research use only. Not for therapeutic Use.
Diphenyl Methylphosphonate is an organophosphorus compound widely used in organic synthesis and as a reagent in chemical research. Its structure features two phenyl groups attached to a methylphosphonate moiety, contributing to its stability and reactivity. This compound serves as a versatile building block in the synthesis of various pharmaceuticals, agrochemicals, and other bioactive molecules. It is known for its ability to participate in phosphorylation reactions, facilitating the introduction of phosphonate groups into target molecules. Additionally, Diphenyl Methylphosphonate is explored for its potential applications in enzyme inhibition studies and as a tool for probing biochemical pathways in research settings.
| Catalog Number | R023861 |
| CAS Number | 7526-26-3 |
| Synonyms | Diphenyl Methanephosphonate; Methylphosphonic Acid Diphenyl Ester; P-Methylphosphonic Acid Diphenyl Ester |
| Molecular Formula | C13H13O3P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [methyl(phenoxy)phosphoryl]oxybenzene |
| InChI | InChI=1S/C13H13O3P/c1-17(14,15-12-8-4-2-5-9-12)16-13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | HPUPGAFDTWIMBR-UHFFFAOYSA-N |
| SMILES | CP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2 |
