Diphenyl(2-methoxyphenyl)phosphine(Cat No.:L007137), is a chemical compound with the molecular formula C19H17OP. It features a phosphorus atom bound to two phenyl rings and a 2-methoxyphenyl group. This compound belongs to the class of organophosphorus compounds and is widely used in coordination chemistry as a ligand for transition metal complexes. Such complexes find applications in catalysis, organic synthesis, and material science. The unique structure of Diphenyl(2-methoxyphenyl)phosphine allows it to participate in a variety of chemical reactions, making it valuable in the creation of complex molecules and advancing research in various fields of chemistry.
Catalog Number | L007137 |
CAS Number | 53111-20-9 |
Molecular Formula | C19H17OP |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (2-methoxyphenyl)-diphenylphosphane |
InChI | InChI=1S/C19H17OP/c1-20-18-14-8-9-15-19(18)21(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-15H,1H3 |
InChIKey | GBXNVYBGIFEOEM-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3 |