For research use only. Not for therapeutic Use.
Diphenyliodonium iodide (Cat No.:R070013) is a chemical compound widely used as a photoinitiator in photopolymerization processes. It plays a crucial role in the initiation of photochemical reactions, particularly in UV-curable coatings, adhesives, and printing inks. When exposed to UV or visible light, diphenyliodonium iodide undergoes a photolytic reaction, releasing a Lewis acid, which initiates the polymerization of monomers in the surrounding material.
CAS Number | 2217-79-0 |
Molecular Formula | C12H10I2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | diphenyliodanium;iodide |
InChI | InChI=1S/C12H10I.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;1H/q+1;/p-1 |
InChIKey | WQIRVUAXANLUPO-UHFFFAOYSA-M |
SMILES | C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[I-] |