For research use only. Not for therapeutic Use.
Diphenyl(o-tolyl)phosphine is a versatile phosphine ligand featuring two phenyl groups and an ortho-tolyl group attached to phosphorus. Its unique electronic properties make it suitable for catalysis in various chemical reactions, including cross-coupling and hydrogenation. Commonly used in organometallic and coordination chemistry, Diphenyl(o-tolyl)phosphine enhances reaction selectivity and stability. This ligand supports high-performance synthesis in both pharmaceutical and industrial applications, facilitating the creation of complex organic molecules with high efficiency and precision.
CAS Number | 5931-53-3 |
Molecular Formula | C19H17P |
Purity | ≥95% |
IUPAC Name | (2-methylphenyl)-diphenylphosphane |
InChI | InChI=1S/C19H17P/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-15H,1H3 |
InChIKey | MLBZLJCMHFCTQM-UHFFFAOYSA-N |
SMILES | CC1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |