For research use only. Not for therapeutic Use.
Diphenylzinc (Cat No.:M068620) is an organozinc compound that is primarily used as a versatile reagent in organic synthesis. It contains a zinc atom bonded to two phenyl groups and is valuable in a variety of chemical reactions, including the formation of carbon-carbon and carbon-heteroatom bonds. Diphenylzinc is often employed in processes like the Grignard reaction and cross-coupling reactions, facilitating the creation of complex organic molecules. Its ability to serve as a source of nucleophilic carbon makes it a valuable tool in the development of pharmaceuticals, agrochemicals, and specialty chemicals, contributing to advancements in organic chemistry research.
CAS Number | 1078-58-6 |
Molecular Formula | C12H10Zn |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | zinc;benzene |
InChI | InChI=1S/2C6H5.Zn/c2*1-2-4-6-5-3-1;/h2*1-5H;/q2*-1;+2 |
InChIKey | BUNROVZNGITPIX-UHFFFAOYSA-N |
SMILES | C1=CC=[C-]C=C1.C1=CC=[C-]C=C1.[Zn+2] |