Home
>
Reference Standards> Diphosphoric acid, mono[(1alpha,2beta,3alpha,4alpha,5alpha,6beta)-2,3, 4,5,6-pentakis(phosphonooxy)cyclohexyl] ester
For research use only. Not for therapeutic Use.
Diphosphoric acid, mono[(1alpha,2beta,3alpha,4alpha,5alpha,6beta)-2,3, 4,5,6-pentakis(phosphonooxy)cyclohexyl] ester(Cat No.:M101310) is a highly complex molecule characterized by a cyclohexyl ring where each carbon atom in the ring is substituted with a phosphonooxy group. This structure makes the compound a potent chelating agent capable of binding multiple metal ions through its phosphonate groups. The additional diphosphoric acid group may enhance its binding capabilities or solubility. This molecule is primarily of interest in chemistry and materials science for its potential applications in catalysis, ion exchange, and as a stabilizer or additive in various formulations due to its multiple coordination sites.
CAS Number | 149714-25-0 |
Molecular Formula | C6H19O27P7 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | [(2S,3R,5S,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphono hydrogen phosphate |
InChI | InChI=1S/C6H19O27P7/c7-34(8,9)27-1-2(28-35(10,11)12)4(30-37(16,17)18)6(32-40(25,26)33-39(22,23)24)5(31-38(19,20)21)3(1)29-36(13,14)15/h1-6H,(H,25,26)(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t1?,2-,3+,4+,5-,6? |
InChIKey | UPHPWXPNZIOZJL-UYSNGIAKSA-N |
SMILES | C1(C(C(C(C(C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |