For research use only. Not for therapeutic Use.
Di(piperidin-1-yl)methanethione is an organosulfur compound featuring two piperidine groups attached to a central methanethione (thioketone) group. It is primarily used in organic synthesis and pharmaceutical research as a versatile intermediate for the development of bioactive molecules. The presence of piperidine rings makes it valuable in drug discovery, particularly in the synthesis of compounds targeting various biological receptors. Its unique reactivity allows for further chemical modifications, contributing to advancements in medicinal chemistry and material science.
| Catalog Number | L024556 |
| CAS Number | 1013-92-9 |
| Molecular Formula | C11H20N2S |
| Purity | ≥95% |
| IUPAC Name | di(piperidin-1-yl)methanethione |
| InChI | InChI=1S/C11H20N2S/c14-11(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H2 |
| InChIKey | UOOSIBHMBCFJRY-UHFFFAOYSA-N |
