For research use only. Not for therapeutic Use.
Dipotassium dihydrogen pyrophosphate (Cat No.:M055357), also known as potassium acid pyrophosphate, is a white, water-soluble chemical compound with the formula K2H2P2O7. It functions primarily as a leavening agent in baked goods, where it reacts with baking soda to release carbon dioxide, helping doughs and batters rise. Beyond its use in the food industry, DKP is utilized in the production of ceramics and toothpaste, acting as a tartar control agent. It also serves as a buffering agent, stabilizer, and sequestrant, binding to metals to improve the stability and appearance of various products.
| Catalog Number | M055357 |
| CAS Number | 14691-84-0 |
| Molecular Formula | H2K2O7P2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | dipotassium;[hydroxy(oxido)phosphoryl] hydrogen phosphate |
| InChI | InChI=1S/2K.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+1;/p-2 |
| InChIKey | CQAIPTBBCVQRMD-UHFFFAOYSA-L |
| SMILES | OP(=O)([O-])OP(=O)(O)[O-].[K+].[K+] |
