For research use only. Not for therapeutic Use.
Diprovocim（Cat No.:I026281）is a synthetic small molecule that acts as an immune system modulator, specifically designed to enhance the activation of the innate immune system through the stimulation of the NOD-like receptor (NLR) family. It functions as a potent agonist of the NLRP3 inflammasome, leading to the production of pro-inflammatory cytokines like IL-1β and IL-18. Diprovocim has been investigated for its potential use in immunotherapy and vaccine adjuvants, as it may help boost immune responses against infections and tumors. Additionally, it is being explored for its possible applications in treating immune-related disorders and enhancing vaccine efficacy.
| Catalog Number | I026281 |
| CAS Number | 2170867-89-5 |
| Synonyms | Diprovocim; Diprovocim-1; |
| Molecular Formula | C56H56N6O6 |
| Purity | 98% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (3S,4S)-1-[4-[(3S,4S)-3,4-bis[[(1S,2R)-2-phenylcyclopropyl]carbamoyl]pyrrolidine-1-carbonyl]benzoyl]-3-N,4-N-bis[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide |
| InChI | InChI=1S/C56H56N6O6/c63-51(57-47-25-39(47)33-13-5-1-6-14-33)43-29-61(30-44(43)52(64)58-48-26-40(48)34-15-7-2-8-16-34)55(67)37-21-23-38(24-22-37)56(68)62-31-45(53(65)59-49-27-41(49)35-17-9-3-10-18-35)46(32-62)54(66)60-50-28-42(50)36-19-11-4-12-20-36/h1-24,39-50H,25-32H2,(H,57,63)(H,58,64)(H,59,65)(H,60,66)/t39-,40-,41-,42-,43-,44-,45-,46-,47+,48+,49+,50+/m1/s1 |
| InChIKey | ABZBNXFGYUSVCJ-UYMKNZQYSA-N |
| SMILES | C1[C@@H]([C@H]1NC(=O)[C@@H]2CN(C[C@H]2C(=O)N[C@H]3C[C@@H]3C4=CC=CC=C4)C(=O)C5=CC=C(C=C5)C(=O)N6C[C@H]([C@@H](C6)C(=O)N[C@H]7C[C@@H]7C8=CC=CC=C8)C(=O)N[C@H]9C[C@@H]9C1=CC=CC=C1)C1=CC=CC=C1 |
| Reference | 1: Su L, Wang Y, Wang J, Mifune Y, Morin MD, Jones BT, Moresco EM, Boger DL, |
