For research use only. Not for therapeutic Use.
Dipyrocetyl(CAT: I020695) is a synthetic compound known for its anti-inflammatory and antipyretic properties. It functions by inhibiting prostaglandin synthesis, a mechanism similar to that of nonsteroidal anti-inflammatory drugs (NSAIDs). Dipyrocetyl is used in pharmacological research to study inflammation pathways and the modulation of fever and pain responses. Its applications extend to exploring potential therapeutic strategies for managing inflammatory diseases and conditions associated with elevated prostaglandin levels.
| Catalog Number | I020695 |
| CAS Number | 486-79-3 |
| Molecular Formula | C₁₁H₁₀O₆ |
| Purity | ≥95% |
| IUPAC Name | 2,3-diacetyloxybenzoic acid |
| InChI | InChI=1S/C11H10O6/c1-6(12)16-9-5-3-4-8(11(14)15)10(9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
| InChIKey | NYIZXMGNIUSNKL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1OC(=O)C)C(=O)O |
