For research use only. Not for therapeutic Use.
Dipyrrometheneboron Difluoride (Cat.No:R017641) is a synthetic dye molecule known for its bright fluorescence properties. It is widely used in various applications, including fluorescence microscopy, chemical sensing, and biological labeling. Its strong fluorescence and photostability make it a valuable tool in scientific research and diagnostic assays.
| CAS Number | 138026-71-8 |
| Synonyms | BODIPY; (T-4)-Difluoro[2-(2H-pyrrol-2-ylidenemethyl)-1H-pyrrolato-N1,N2]boron; (T-4)-Difluoro[2-[(2H-pyrrol-2-ylidene-κN)methyl]-1H-pyrrolato-κN]boron; |
| Molecular Formula | C9H7BF2N2 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C9H7BF2N2/c11-10(12)13-5-1-3-8(13)7-9-4-2-6-14(9)10/h1-7H |
| InChIKey | GUHHEAYOTAJBPT-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C=CC=C2C=C3[N+]1=CC=C3)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
