For research use only. Not for therapeutic Use.
Dipyrrometheneboron Difluoride (Cat.No:R017641) is a synthetic dye molecule known for its bright fluorescence properties. It is widely used in various applications, including fluorescence microscopy, chemical sensing, and biological labeling. Its strong fluorescence and photostability make it a valuable tool in scientific research and diagnostic assays.
| Catalog Number | R017641 |
| CAS Number | 138026-71-8 |
| Synonyms | BODIPY; (T-4)-Difluoro[2-(2H-pyrrol-2-ylidenemethyl)-1H-pyrrolato-N1,N2]boron; (T-4)-Difluoro[2-[(2H-pyrrol-2-ylidene-κN)methyl]-1H-pyrrolato-κN]boron; |
| Molecular Formula | C9H7BF2N2 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C9H7BF2N2/c11-10(12)13-5-1-3-8(13)7-9-4-2-6-14(9)10/h1-7H |
| InChIKey | GUHHEAYOTAJBPT-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C=CC=C2C=C3[N+]1=CC=C3)(F)F |
