For research use only. Not for therapeutic Use.
Disodium 2′-deoxyuridylate(Cat No.:L016845)is a chemical compound consisting of a nucleotide, specifically the uridine derivative 2′-deoxyuridylate (dUMP), paired with two sodium ions. It is a deoxyuridine monophosphate, where the sugar backbone lacks an oxygen atom at the 2′ position, distinguishing it from ribonucleotides. As a building block of DNA, 2′-deoxyuridylate plays a key role in DNA metabolism and replication, particularly in thymidine biosynthesis. It is used in biochemical studies to explore nucleotide interactions, DNA synthesis, and the effects of uracil incorporation into DNA.
CAS Number | 42155-08-8 |
Molecular Formula | C9H11N2Na2O8P |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | disodium;[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl phosphate |
InChI | InChI=1S/C9H13N2O8P.2Na/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17;;/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17);;/q;2*+1/p-2/t5-,6+,8+;;/m0../s1 |
InChIKey | FXVXMLXAXVVONE-CDNBRZBRSA-L |
SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)([O-])[O-])O.[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |