For research use only. Not for therapeutic Use.
Disophenol（Cat No.:I026301）is a high-purity phenolic compound known for its antiparasitic properties, widely used in veterinary medicine. This compound acts as a potent anthelmintic, particularly effective against gastrointestinal parasites in animals. Its chemical structure enables it to disrupt the metabolic processes of parasites, making it valuable in the treatment and prevention of parasitic infections. Disophenol is utilized in both research and practical applications, contributing to advancements in veterinary care and the development of more effective antiparasitic treatments.
| Catalog Number | I026301 |
| CAS Number | 305-85-1 |
| Synonyms | Disophenol; BRN2052233; BRN-2052233; BRN 2052233 |
| Molecular Formula | C6H3I2NO3 |
| Purity | ≥95% |
| IUPAC Name | 2,6-diiodo-4-nitrophenol |
| InChI | InChI=1S/C6H3I2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H |
| InChIKey | UVGTXNPVQOQFQW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)O)I)[N+](=O)[O-] |
