For research use only. Not for therapeutic Use.
Disuccinimidyl glutarate (DSG) is a homobifunctional crosslinking agent that contains amine-reactive N-hydroxysuccinimide (NHS) ester groups at each end. DSG is membrane-permeable and non-cleavable. DSG can be combined with formaldehyde fixation to improve the detection of specific protein-DNA complexes.
| Catalog Number | R066819 |
| CAS Number | 79642-50-5 |
| Synonyms | DSG |
| Molecular Formula | C13H14N2O8 |
| Purity | ≥95% |
| Target | ADC Linker |
| Storage | -20°C |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) pentanedioate |
| InChI | InChI=1S/C13H14N2O8/c16-8-4-5-9(17)14(8)22-12(20)2-1-3-13(21)23-15-10(18)6-7-11(15)19/h1-7H2 |
| InChIKey | LNQHREYHFRFJAU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCC(=O)ON2C(=O)CCC2=O |
| Reference | 1.Akin, B.L. and Jones, L.R. Characterizing phospholamban to sarco(endo)plasmic reticulum Ca2+-ATPase 2a (SERCA2a) protein binding interactions in human cardiac sarcoplasmic reticulum vesicles using chemical cross-linking. J. Biol. Chem. 287(10), 7582-759 |
