For research use only. Not for therapeutic Use.
Dithiobissuccinimidyl Propionate-d8 is a deuterated crosslinking reagent featuring eight deuterium atoms, making it an invaluable tool in protein chemistry and bioconjugation studies. This compound is widely used for covalent bonding of biomolecules, particularly in the formation of stable protein-protein or protein-peptide conjugates. The stable isotope labeling of Dithiobissuccinimidyl Propionate-d8 allows for precise mass spectrometric analysis, enabling accurate identification and quantification of crosslinked species. It is essential for research involving protein structure, function, and interaction studies, offering enhanced reliability and consistency in experimental outcomes in proteomics and biochemical research.
CAS Number | 1639836-65-9 |
Synonyms | 1,1’-[Dithiobis[(1-oxo-3,1-propanediyl)oxy]]bis-2,5-pyrrolidinedione; 3,3’-Dithio(succinimidyl Propionate); 3,3’-Dithiobis(N-hydroxysuccinimidylpropionate); 3,3’-Dithiobis(succinimidyl Propionate); 3,3’-Dithioldipropionic Acid bis(N-hydroxysuccinimid |
Molecular Formula | C14H16N2O8S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,2,3,3-tetradeuterio-3-[[1,1,2,2-tetradeuterio-3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]disulfanyl]propanoate |
InChI | InChI=1S/C14H16N2O8S2/c17-9-1-2-10(18)15(9)23-13(21)5-7-25-26-8-6-14(22)24-16-11(19)3-4-12(16)20/h1-8H2/i5D2,6D2,7D2,8D2 |
InChIKey | FXYPGCIGRDZWNR-YEBVBAJPSA-N |
SMILES | [2H]C([2H])(C(=O)ON1C(=O)CCC1=O)C([2H])([2H])SSC([2H])([2H])C([2H])([2H])C(=O)ON2C(=O)CCC2=O |