For research use only. Not for therapeutic Use.
Divalproex sodium(Cat No.:A000239)is a widely used medication primarily prescribed for the treatment of epilepsy, bipolar disorder, and migraine prevention. It works by increasing gamma-aminobutyric acid (GABA) levels in the brain, which helps stabilize neuronal activity and prevent seizures. Additionally, it regulates mood by balancing neurotransmitter levels, making it effective in managing manic episodes in bipolar disorder. Divalproex sodium is also used to reduce the frequency of migraines. While generally well-tolerated, it can cause side effects like nausea, dizziness, and liver function changes in some patients.
CAS Number | 76584-70-8 |
Synonyms | NA |
Molecular Formula | C16H31NaO4 |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
Solubility | >14.2mg/mL in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | sodium;2-propylpentanoate;2-propylpentanoic acid |
InChI | InChI=1S/2C8H16O2.Na/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+1/p-1 |
InChIKey | MSRILKIQRXUYCT-UHFFFAOYSA-M |
SMILES | CCCC(CCC)C(=O)O.CCCC(CCC)C(=O)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |