For research use only. Not for therapeutic Use.
Divinyl sebacate (Cat No.:M064348) is a versatile chemical compound, crucial in polymer chemistry. It’s synthesized by condensing sebacic acid with divinyl ether. DVS serves as a monomer, contributing to the formation of various polymers, notably polyesters, and specialty materials. Its applications span diverse industries, including adhesives, coatings, biomedical materials, and electronics.
CAS Number | 10355-50-7 |
Molecular Formula | C14H22O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | bis(ethenyl) decanedioate |
InChI | InChI=1S/C14H22O4/c1-3-17-13(15)11-9-7-5-6-8-10-12-14(16)18-4-2/h3-4H,1-2,5-12H2 |
InChIKey | CHQUIOWVSPIVJB-UHFFFAOYSA-N |
SMILES | C=COC(=O)CCCCCCCCC(=O)OC=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |