For research use only. Not for therapeutic Use.
Divinylbenzene (Cat No.:M047748) is an essential organic compound consisting of a benzene ring substituted with two vinyl groups at the para positions. This structure allows it to act as a cross-linking agent in the production of polymer resins, notably in the manufacture of styrene-divinylbenzene copolymers. These copolymers are used extensively in ion exchange resins and as supports for various catalysts and adsorbents. Divinylbenzene enhances polymers’ thermal and chemical stability and is crucial in applications requiring durable, robust materials. It typically appears as a clear, colorless liquid with a distinctive aromatic odor.
| Catalog Number | M047748 |
| CAS Number | 1321-74-0 |
| Molecular Formula | C10H10 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,2-bis(ethenyl)benzene |
| InChI | InChI=1S/C10H10/c1-3-9-7-5-6-8-10(9)4-2/h3-8H,1-2H2 |
| InChIKey | MYRTYDVEIRVNKP-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=CC=C1C=C |
