For research use only. Not for therapeutic Use.
Divinylsulfoxide (Cat.No:M047659) is a chemical compound used as a reagent in organic synthesis. It contains two vinyl groups attached to a sulfoxide functional group. Divinylsulfoxide is employed in various reactions, including the preparation of organic compounds and pharmaceutical intermediates, making it valuable in research and industrial processes.
| CAS Number | 1115-15-7 |
| Molecular Formula | C4H6OS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-ethenylsulfinylethene |
| InChI | InChI=1S/C4H6OS/c1-3-6(5)4-2/h3-4H,1-2H2 |
| InChIKey | HQSMEHLVLOGBCK-UHFFFAOYSA-N |
| SMILES | C=CS(=O)C=C |
