For research use only. Not for therapeutic Use.
Dixanthogen(Cat No.:I003773)is an organosulfur compound commonly used as a flotation agent in mineral processing. It is formed from xanthates under oxidizing conditions and plays a critical role in enhancing the hydrophobicity of sulfide ores, such as those containing copper, zinc, or lead, facilitating their separation from non-sulfide materials. Dixanthogen’s ability to adsorb onto mineral surfaces improves recovery rates and efficiency in flotation processes. Additionally, its reactivity and role in industrial applications make it a valuable compound in metallurgical research and the development of sustainable ore beneficiation techniques.
Catalog Number | I003773 |
CAS Number | 502-55-6 |
Molecular Formula | C6H10O2S4 |
Purity | ≥95% |
Target | Parasite |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | O-ethyl (ethoxycarbothioyldisulfanyl)methanethioate |
InChI | InChI=1S/C6H10O2S4/c1-3-7-5(9)11-12-6(10)8-4-2/h3-4H2,1-2H3 |
InChIKey | FVIGODVHAVLZOO-UHFFFAOYSA-N |
SMILES | CCOC(=S)SSC(=S)OCC |
Reference | <p style=/line-height:25px/> |