For research use only. Not for therapeutic Use.
DiZPK(CAT: I001286) is a genetically encoded amino acid with photocrosslinking properties. This compound can be used to study protein-protein interactions and elucidate the physiological roles and functions of specific proteins. The high efficiency of DiZPK as a photocrosslinking agent makes it valuable for identifying and characterizing protein interaction partners.
Catalog Number | I001286 |
CAS Number | 1337883-32-5 |
Molecular Formula | C12H23N5O3 |
Purity | ≥95% |
Solubility | DMSO: ≤ 0.29 mg/mL (Need ultrasonic and warming) |
Storage | Store at -20 C |
IUPAC Name | (2S)-2-amino-6-[3-(3-methyldiazirin-3-yl)propylcarbamoylamino]hexanoic acid |
InChI | InChI=1S/C12H23N5O3/c1-12(16-17-12)6-4-8-15-11(20)14-7-3-2-5-9(13)10(18)19/h9H,2-8,13H2,1H3,(H,18,19)(H2,14,15,20)/t9-/m0/s1 |
InChIKey | YGUIFRMUMYTGAV-VIFPVBQESA-N |
SMILES | CC1(N=N1)CCCNC(=O)NCCCCC(C(=O)O)N |
Reference | <p style=”/line-height:25px/”> |