For research use only. Not for therapeutic Use.
DJ001（Cat No.:I017346）is a potent small-molecule activator of AMP-activated protein kinase (AMPK), a critical enzyme involved in cellular energy homeostasis. By activating AMPK, DJ001 enhances glucose uptake, improves insulin sensitivity, and promotes lipid oxidation, making it a promising compound for treating metabolic disorders such as type 2 diabetes and obesity. DJ001 has shown potential in preclinical studies for reducing blood glucose levels and improving metabolic profiles. Its mechanism of action supports its role in regulating energy balance, positioning it as a valuable candidate for metabolic disease research and therapeutic development.
| Catalog Number | I017346 |
| CAS Number | 2161305-12-8 |
| Molecular Formula | C₁₅H₁₂N₂O₃ |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | (Z)-3-(3-nitroanilino)-1-phenylprop-2-en-1-one |
| InChI | InChI=1S/C15H12N2O3/c18-15(12-5-2-1-3-6-12)9-10-16-13-7-4-8-14(11-13)17(19)20/h1-11,16H/b10-9- |
| InChIKey | OVTJWWUGQKIRCL-KTKRTIGZSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C\NC2=CC(=CC=C2)[N+](=O)[O-] |
| Reference | [1]. Zhang Y, et al. PTPσ inhibitors promote hematopoietic stem cell regeneration. Nat Commun. 2019 Aug 14;10(1):3667. |
