For research use only. Not for therapeutic Use.
DJ101（Cat No.:I026333）is a selective inhibitor of the enzyme DNA-dependent protein kinase (DNA-PK), which plays a key role in DNA repair and maintaining genomic stability. By inhibiting DNA-PK, DJ101 disrupts DNA repair mechanisms, particularly those involved in the repair of double-strand breaks. This makes DJ101 a promising candidate in cancer therapy, as it can sensitize tumor cells to radiation and chemotherapy by impairing their ability to repair damaged DNA. Research is ongoing to explore its potential in enhancing the efficacy of cancer treatments and targeting DNA repair pathways in various malignancies.
| CAS Number | 1803242-21-8 |
| Synonyms | 2-(1H-indol-4-yl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazo[4,5-c]pyridine |
| Molecular Formula | C23H20N4O3 |
| Purity | ≥95% |
| IUPAC Name | 2-(1H-indol-4-yl)-4-(3,4,5-trimethoxyphenyl)-1H-imidazo[4,5-c]pyridine |
| InChI | InChI=1S/C23H20N4O3/c1-28-18-11-13(12-19(29-2)22(18)30-3)20-21-17(8-10-25-20)26-23(27-21)15-5-4-6-16-14(15)7-9-24-16/h4-12,24H,1-3H3,(H,26,27) |
| InChIKey | GZJHBGSBVSNHCJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=NC=CC3=C2N=C(N3)C4=C5C=CNC5=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
