For research use only. Not for therapeutic Use.
Djalonensone-d₃(CAT: I040844) is a deuterium-labeled analog of djalonensone, a naturally occurring quinonoid compound known for its potential cytotoxic and anticancer properties. The incorporation of three deuterium atoms makes it ideal for use as an internal standard in mass spectrometry-based quantitative analysis, ensuring precise tracking and differentiation from the unlabeled compound. Djalonensone-d₃ is valuable in pharmacokinetic, metabolic, and bioavailability studies, particularly in cancer research and natural product profiling. Its stable isotope labeling enhances analytical accuracy in complex biological matrices, supporting research in drug discovery, toxicology, and natural product chemistry. Suitable for LC-MS and related applications.
| CAS Number | 2468774-90-3 |
| Synonyms | 3,7-dihydroxy-1-methyl-9-(trideuteriomethoxy)benzo[c]chromen-6-one |
| Molecular Formula | C15H9D3O5 |
| Purity | ≥95% |
| IUPAC Name | 3,7-dihydroxy-1-methyl-9-(trideuteriomethoxy)benzo[c]chromen-6-one |
| InChI | InChI=1S/C15H12O5/c1-7-3-8(16)4-12-13(7)10-5-9(19-2)6-11(17)14(10)15(18)20-12/h3-6,16-17H,1-2H3/i2D3 |
| InChIKey | LCSDQFNUYFTXMT-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C(=C1)O)C(=O)OC3=C2C(=CC(=C3)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
