For research use only. Not for therapeutic Use.
DK3 is a potent and selective estrogen-related receptor alpha (ERRα) agonist[1].
| Catalog Number | I044077 |
| CAS Number | 1187568-16-6 |
| Synonyms | 7-methoxy-3-methyl-2-phenylquinazolin-4-one |
| Molecular Formula | C16H14N2O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H14N2O2/c1-18-15(11-6-4-3-5-7-11)17-14-10-12(20-2)8-9-13(14)16(18)19/h3-10H,1-2H3 |
| InChIKey | CAPYSCGIBNZCLS-UHFFFAOYSA-N |
| SMILES | CN1C(=NC2=C(C1=O)C=CC(=C2)OC)C3=CC=CC=C3 |
| Reference | [1]. Lu G , et al. Subresidue-Resolution Footprinting of Ligand-Protein Interactions by Carbene Chemistry and Ion Mobility-Mass Spectrometry. Anal Chem. 2020;92(1):947-956. |
