For research use only. Not for therapeutic Use.
D, L-α-Aminopimelic acid(Cat No.:R001425) is a compound that serves as a key intermediate in the biosynthesis of lysine, an essential amino acid in bacteria and plants. It contains an α-amino group and a carboxylic acid group, attached to a pimelic acid moiety. This compound plays a crucial role in cell wall biosynthesis in certain bacteria, serving as a precursor for the cross-linking of peptidoglycan strands. Due to its involvement in bacterial cell wall formation, D, L-α-aminopimelic acid has been a target for antibiotic development.
CAS Number | 627-76-9 |
Synonyms | 2-Aminoheptanedioic Acid; NSC 402480; (+/-)-2-Amino-heptanedioic Acid; |
Molecular Formula | C7H13NO4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-aminoheptanedioic acid |
InChI | InChI=1S/C7H13NO4/c8-5(7(11)12)3-1-2-4-6(9)10/h5H,1-4,8H2,(H,9,10)(H,11,12) |
InChIKey | JUQLUIFNNFIIKC-UHFFFAOYSA-N |
SMILES | C(CCC(=O)O)CC(C(=O)O)N |