For research use only. Not for therapeutic Use.
DL-3-Phenylalanine-13C-1(Cat No.:S000708) is a labeled form of DL-3-Phenylalanine, where the first carbon atom in the phenyl group is enriched with carbon-13, enhancing its detectability in analytical techniques such as NMR spectroscopy and mass spectrometry. This isotopic labeling is critical for studying the metabolic pathways and enzyme interactions involving phenylalanine. DL-3-Phenylalanine is a racemic mixture of the L- and D- forms of the amino acid, used in research to explore protein synthesis and structure. The carbon-13 labeling at a specific position allows for targeted investigations into the amino acid’s incorporation into proteins and its behavior in various biochemical processes.
CAS Number | 64193-01-7 |
Molecular Formula | C813CH11NO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-3-phenyl(213C)propanoic acid |
InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i8+1 |
InChIKey | COLNVLDHVKWLRT-VJJZLTLGSA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |